C14H22BrFN4 — CID 107536608
2-bromo-4-[3-(dimethylamino)propyl-ethylamino]-3-fluorobenzenecarboximidamide (PubChem CID 107536608) has the molecular formula C14H22BrFN4 and a molecular weight of 345.26 g/mol. Its IUPAC name is 2-bromo-4-[3-(dimethylamino)propyl-ethylamino]-3-fluorobenzenecarboximidamide.
| Compound Name | 2-bromo-4-[3-(dimethylamino)propyl-ethylamino]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107536608 |
| Molecular Formula | C14H22BrFN4 |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-bromo-4-[3-(dimethylamino)propyl-ethylamino]-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(CC)CCCN(C)C)c(F)c1Br |
| InChI | InChI=1S/C14H22BrFN4/c1-4-20(9-5-8-19(2)3)11-7-6-10(14(17)18)12(15)13(11)16/h6-7H,4-5,8-9H2,1-3H3,(H3,17,18) |
| InChIKey | XXJVBZIKGKKAQI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|