C15H19BrFN3 — CID 107536514
4-[bis(cyclopropylmethyl)amino]-2-bromo-3-fluorobenzenecarboximidamide (PubChem CID 107536514) has the molecular formula C15H19BrFN3 and a molecular weight of 340.24 g/mol. Its IUPAC name is 4-[bis(cyclopropylmethyl)amino]-2-bromo-3-fluorobenzenecarboximidamide.
| Compound Name | 4-[bis(cyclopropylmethyl)amino]-2-bromo-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107536514 |
| Molecular Formula | C15H19BrFN3 |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-[bis(cyclopropylmethyl)amino]-2-bromo-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(CC2CC2)CC2CC2)c(F)c1Br |
| InChI | InChI=1S/C15H19BrFN3/c16-13-11(15(18)19)5-6-12(14(13)17)20(7-9-1-2-9)8-10-3-4-10/h5-6,9-10H,1-4,7-8H2,(H3,18,19) |
| InChIKey | OUOHKNOQISZXLP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|