C13H19BrFN3O — CID 107536617
2-bromo-3-fluoro-4-[5-hydroxypentyl(methyl)amino]benzenecarboximidamide (PubChem CID 107536617) has the molecular formula C13H19BrFN3O and a molecular weight of 332.22 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[5-hydroxypentyl(methyl)amino]benzenecarboximidamide.
| Compound Name | 2-bromo-3-fluoro-4-[5-hydroxypentyl(methyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107536617 |
| Molecular Formula | C13H19BrFN3O |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-bromo-3-fluoro-4-[5-hydroxypentyl(methyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CCCCCO)c(F)c1Br |
| InChI | InChI=1S/C13H19BrFN3O/c1-18(7-3-2-4-8-19)10-6-5-9(13(16)17)11(14)12(10)15/h5-6,19H,2-4,7-8H2,1H3,(H3,16,17) |
| InChIKey | KXLLUCZZCRGMDJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|