C11H12BrF4N3 — CID 107536524
2-bromo-3-fluoro-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarboximidamide (PubChem CID 107536524) has the molecular formula C11H12BrF4N3 and a molecular weight of 342.13 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarboximidamide.
| Compound Name | 2-bromo-3-fluoro-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107536524 |
| Molecular Formula | C11H12BrF4N3 |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-bromo-3-fluoro-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CCC(F)(F)F)c(F)c1Br |
| InChI | InChI=1S/C11H12BrF4N3/c1-19(5-4-11(14,15)16)7-3-2-6(10(17)18)8(12)9(7)13/h2-3H,4-5H2,1H3,(H3,17,18) |
| InChIKey | QDGYUVWZNJBISY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|