C12H16F3N3 — CID 81278791
2-methyl-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarboximidamide (PubChem CID 81278791) has the molecular formula C12H16F3N3 and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-methyl-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarboximidamide.
| Compound Name | 2-methyl-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 81278791 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-methyl-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CCC(F)(F)F)cc1C |
| InChI | InChI=1S/C12H16F3N3/c1-8-7-9(3-4-10(8)11(16)17)18(2)6-5-12(13,14)15/h3-4,7H,5-6H2,1-2H3,(H3,16,17) |
| InChIKey | DAVMUSISCXOGLI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|