C10H13F3N2 — CID 64566301
4-N-methyl-4-N-(3,3,3-trifluoropropyl)benzene-1,4-diamine (PubChem CID 64566301) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-N-methyl-4-N-(3,3,3-trifluoropropyl)benzene-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-(3,3,3-trifluoropropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 64566301 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 4-N-methyl-4-N-(3,3,3-trifluoropropyl)benzene-1,4-diamine |
| SMILES | CN(CCC(F)(F)F)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H13F3N2/c1-15(7-6-10(11,12)13)9-4-2-8(14)3-5-9/h2-5H,6-7,14H2,1H3 |
| InChIKey | AULMOFPLVGPTQW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|