C16H20N2 — CID 28894846
4-N-methyl-4-N-(3-phenylpropyl)benzene-1,4-diamine (PubChem CID 28894846) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-N-methyl-4-N-(3-phenylpropyl)benzene-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-(3-phenylpropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 28894846 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-N-methyl-4-N-(3-phenylpropyl)benzene-1,4-diamine |
| SMILES | CN(CCCc1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H20N2/c1-18(16-11-9-15(17)10-12-16)13-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-12H,5,8,13,17H2,1H3 |
| InChIKey | KOCXQYQAHHVZLE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|