C18H24N2 — CID 81273880
4-(aminomethyl)-N,3-dimethyl-N-(3-phenylpropyl)aniline (PubChem CID 81273880) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-(aminomethyl)-N,3-dimethyl-N-(3-phenylpropyl)aniline.
| Compound Name | 4-(aminomethyl)-N,3-dimethyl-N-(3-phenylpropyl)aniline |
|---|---|
| PubChem CID | 81273880 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-(aminomethyl)-N,3-dimethyl-N-(3-phenylpropyl)aniline |
| SMILES | Cc1cc(N(C)CCCc2ccccc2)ccc1CN |
| InChI | InChI=1S/C18H24N2/c1-15-13-18(11-10-17(15)14-19)20(2)12-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-11,13H,6,9,12,14,19H2,1-2H3 |
| InChIKey | JKIBTKDNSOSATR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|