C13H22N2O2 — CID 114242987
2-[2-[4-(aminomethyl)-N,3-dimethylanilino]ethoxy]ethanol (PubChem CID 114242987) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[2-[4-(aminomethyl)-N,3-dimethylanilino]ethoxy]ethanol.
| Compound Name | 2-[2-[4-(aminomethyl)-N,3-dimethylanilino]ethoxy]ethanol |
|---|---|
| PubChem CID | 114242987 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-[2-[4-(aminomethyl)-N,3-dimethylanilino]ethoxy]ethanol |
| SMILES | Cc1cc(N(C)CCOCCO)ccc1CN |
| InChI | InChI=1S/C13H22N2O2/c1-11-9-13(4-3-12(11)10-14)15(2)5-7-17-8-6-16/h3-4,9,16H,5-8,10,14H2,1-2H3 |
| InChIKey | CVPIJOWJAFJMMP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|