C14H24N2O — CID 63783455
4-(2-aminoethyl)-N-(3-methoxypropyl)-N,3-dimethylaniline (PubChem CID 63783455) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(3-methoxypropyl)-N,3-dimethylaniline.
| Compound Name | 4-(2-aminoethyl)-N-(3-methoxypropyl)-N,3-dimethylaniline |
|---|---|
| PubChem CID | 63783455 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 4-(2-aminoethyl)-N-(3-methoxypropyl)-N,3-dimethylaniline |
| SMILES | COCCCN(C)c1ccc(CCN)c(C)c1 |
| InChI | InChI=1S/C14H24N2O/c1-12-11-14(6-5-13(12)7-8-15)16(2)9-4-10-17-3/h5-6,11H,4,7-10,15H2,1-3H3 |
| InChIKey | YWVPKMFCFKDKLN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|