C17H30N2 — CID 63783395
4-(2-aminoethyl)-N,N-dibutyl-3-methylaniline (PubChem CID 63783395) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N,N-dibutyl-3-methylaniline.
| Compound Name | 4-(2-aminoethyl)-N,N-dibutyl-3-methylaniline |
|---|---|
| PubChem CID | 63783395 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 4-(2-aminoethyl)-N,N-dibutyl-3-methylaniline |
| SMILES | CCCCN(CCCC)c1ccc(CCN)c(C)c1 |
| InChI | InChI=1S/C17H30N2/c1-4-6-12-19(13-7-5-2)17-9-8-16(10-11-18)15(3)14-17/h8-9,14H,4-7,10-13,18H2,1-3H3 |
| InChIKey | RTXDVYYTWQQRNJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|