C17H21FN2 — CID 63786193
4-(2-aminoethyl)-N-ethyl-N-(2-fluorophenyl)-3-methylaniline (PubChem CID 63786193) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-ethyl-N-(2-fluorophenyl)-3-methylaniline.
| Compound Name | 4-(2-aminoethyl)-N-ethyl-N-(2-fluorophenyl)-3-methylaniline |
|---|---|
| PubChem CID | 63786193 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 4-(2-aminoethyl)-N-ethyl-N-(2-fluorophenyl)-3-methylaniline |
| SMILES | CCN(c1ccc(CCN)c(C)c1)c1ccccc1F |
| InChI | InChI=1S/C17H21FN2/c1-3-20(17-7-5-4-6-16(17)18)15-9-8-14(10-11-19)13(2)12-15/h4-9,12H,3,10-11,19H2,1-2H3 |
| InChIKey | UXQOGBKSTQXZGN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |