C17H23N3 — CID 63784236
4-(2-aminoethyl)-N,3-dimethyl-N-(2-pyridin-2-ylethyl)aniline (PubChem CID 63784236) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N,3-dimethyl-N-(2-pyridin-2-ylethyl)aniline.
| Compound Name | 4-(2-aminoethyl)-N,3-dimethyl-N-(2-pyridin-2-ylethyl)aniline |
|---|---|
| PubChem CID | 63784236 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-(2-aminoethyl)-N,3-dimethyl-N-(2-pyridin-2-ylethyl)aniline |
| SMILES | Cc1cc(N(C)CCc2ccccn2)ccc1CCN |
| InChI | InChI=1S/C17H23N3/c1-14-13-17(7-6-15(14)8-10-18)20(2)12-9-16-5-3-4-11-19-16/h3-7,11,13H,8-10,12,18H2,1-2H3 |
| InChIKey | DGFIPUXYPSJFOG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|