C17H29NO5 — CID 101064678
2-[2-[2-[2-[2-(N-methylanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 101064678) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(N-methylanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-(N-methylanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 101064678 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 2-[2-[2-[2-[2-(N-methylanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CN(CCOCCOCCOCCOCCO)c1ccccc1 |
| InChI | InChI=1S/C17H29NO5/c1-18(17-5-3-2-4-6-17)7-9-20-11-13-22-15-16-23-14-12-21-10-8-19/h2-6,19H,7-16H2,1H3 |
| InChIKey | IFJSVVKWBSVQSM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|