C11H14F3N3O — CID 54962159
2-(4-amino-N-methylanilino)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 54962159) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-(4-amino-N-methylanilino)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-amino-N-methylanilino)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 54962159 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-(4-amino-N-methylanilino)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CN(CC(=O)NCC(F)(F)F)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H14F3N3O/c1-17(9-4-2-8(15)3-5-9)6-10(18)16-7-11(12,13)14/h2-5H,6-7,15H2,1H3,(H,16,18) |
| InChIKey | BCFXGHWLFUPNDK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|