C12H15F3N4O2 — CID 61107945
2,4-diamino-N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (PubChem CID 61107945) has the molecular formula C12H15F3N4O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is 2,4-diamino-N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide.
| Compound Name | 2,4-diamino-N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 61107945 |
| Molecular Formula | C12H15F3N4O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2,4-diamino-N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| SMILES | CN(CC(=O)NCC(F)(F)F)C(=O)c1ccc(N)cc1N |
| InChI | InChI=1S/C12H15F3N4O2/c1-19(5-10(20)18-6-12(13,14)15)11(21)8-3-2-7(16)4-9(8)17/h2-4H,5-6,16-17H2,1H3,(H,18,20) |
| InChIKey | QAKHLNZUYCCXIG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|