C9H11ClF3N3 — CID 115474266
6-chloro-2-N-methyl-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine (PubChem CID 115474266) has the molecular formula C9H11ClF3N3 and a molecular weight of 253.65 g/mol. Its IUPAC name is 6-chloro-2-N-methyl-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-methyl-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115474266 |
| Molecular Formula | C9H11ClF3N3 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 6-chloro-2-N-methyl-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine |
| SMILES | CN(CCC(F)(F)F)c1nc(Cl)ccc1N |
| InChI | InChI=1S/C9H11ClF3N3/c1-16(5-4-9(11,12)13)8-6(14)2-3-7(10)15-8/h2-3H,4-5,14H2,1H3 |
| InChIKey | ITIAQMYFDBQHKI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|