C9H8Cl3F3N2 — CID 102751324
3,5,6-trichloro-N-methyl-N-(3,3,3-trifluoropropyl)pyridin-2-amine (PubChem CID 102751324) has the molecular formula C9H8Cl3F3N2 and a molecular weight of 307.53 g/mol. Its IUPAC name is 3,5,6-trichloro-N-methyl-N-(3,3,3-trifluoropropyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-methyl-N-(3,3,3-trifluoropropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751324 |
| Molecular Formula | C9H8Cl3F3N2 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 3,5,6-trichloro-N-methyl-N-(3,3,3-trifluoropropyl)pyridin-2-amine |
| SMILES | CN(CCC(F)(F)F)c1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl3F3N2/c1-17(3-2-9(13,14)15)8-6(11)4-5(10)7(12)16-8/h4H,2-3H2,1H3 |
| InChIKey | JSGDBZPTNRQRIT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|