C13H18Cl3N3 — CID 102752109
3,5,6-trichloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-N-methylpyridin-2-amine (PubChem CID 102752109) has the molecular formula C13H18Cl3N3 and a molecular weight of 322.67 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-N-methylpyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 102752109 |
| Molecular Formula | C13H18Cl3N3 |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3,5,6-trichloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-N-methylpyridin-2-amine |
| SMILES | CN(CC1(N(C)C)CCC1)c1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl3N3/c1-18(2)13(5-4-6-13)8-19(3)12-10(15)7-9(14)11(16)17-12/h7H,4-6,8H2,1-3H3 |
| InChIKey | LKUUDSPNOGEDOU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|