C12H19IN4 — CID 105420240
N-[[1-(dimethylamino)cyclobutyl]methyl]-5-iodo-N-methylpyrimidin-4-amine (PubChem CID 105420240) has the molecular formula C12H19IN4 and a molecular weight of 346.22 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclobutyl]methyl]-5-iodo-N-methylpyrimidin-4-amine.
| Compound Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-5-iodo-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 105420240 |
| Molecular Formula | C12H19IN4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-5-iodo-N-methylpyrimidin-4-amine |
| SMILES | CN(CC1(N(C)C)CCC1)c1ncncc1I |
| InChI | InChI=1S/C12H19IN4/c1-16(2)12(5-4-6-12)8-17(3)11-10(13)7-14-9-15-11/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | ZFMYKSKVTJLOLQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|