C10H14IN3O — CID 66320423
3-[[(5-iodopyrimidin-4-yl)-methylamino]methyl]cyclobutan-1-ol (PubChem CID 66320423) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is 3-[[(5-iodopyrimidin-4-yl)-methylamino]methyl]cyclobutan-1-ol.
| Compound Name | 3-[[(5-iodopyrimidin-4-yl)-methylamino]methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 66320423 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 3-[[(5-iodopyrimidin-4-yl)-methylamino]methyl]cyclobutan-1-ol |
| SMILES | CN(CC1CC(O)C1)c1ncncc1I |
| InChI | InChI=1S/C10H14IN3O/c1-14(5-7-2-8(15)3-7)10-9(11)4-12-6-13-10/h4,6-8,15H,2-3,5H2,1H3 |
| InChIKey | FEWQWZLRNAPMRE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|