C10H12N4 — CID 126979906
4-[cyclopropylmethyl(methyl)amino]pyrimidine-5-carbonitrile (PubChem CID 126979906) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-[cyclopropylmethyl(methyl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[cyclopropylmethyl(methyl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 126979906 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-[cyclopropylmethyl(methyl)amino]pyrimidine-5-carbonitrile |
| SMILES | CN(CC1CC1)c1ncncc1C#N |
| InChI | InChI=1S/C10H12N4/c1-14(6-8-2-3-8)10-9(4-11)5-12-7-13-10/h5,7-8H,2-3,6H2,1H3 |
| InChIKey | VQSBTMNIOMMIDZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |