C13H22ClN3 — CID 113316760
6-chloro-2-N,2-N-bis(2-methylpropyl)pyridine-2,3-diamine (PubChem CID 113316760) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-bis(2-methylpropyl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N,2-N-bis(2-methylpropyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 113316760 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 6-chloro-2-N,2-N-bis(2-methylpropyl)pyridine-2,3-diamine |
| SMILES | CC(C)CN(CC(C)C)c1nc(Cl)ccc1N |
| InChI | InChI=1S/C13H22ClN3/c1-9(2)7-17(8-10(3)4)13-11(15)5-6-12(14)16-13/h5-6,9-10H,7-8,15H2,1-4H3 |
| InChIKey | NCDPTAKJFIKLIZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|