C12H16ClN3O3 — CID 63379944
2-[(2-amino-2-oxoethyl)-(2-methylpropyl)amino]-6-chloropyridine-3-carboxylic acid (PubChem CID 63379944) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(2-methylpropyl)amino]-6-chloropyridine-3-carboxylic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(2-methylpropyl)amino]-6-chloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63379944 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(2-methylpropyl)amino]-6-chloropyridine-3-carboxylic acid |
| SMILES | CC(C)CN(CC(N)=O)c1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C12H16ClN3O3/c1-7(2)5-16(6-10(14)17)11-8(12(18)19)3-4-9(13)15-11/h3-4,7H,5-6H2,1-2H3,(H2,14,17)(H,18,19) |
| InChIKey | FQYUWDQTSRVXRA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|