C11H14Cl3N3O — CID 102750804
2-[2-methylpropyl-(3,5,6-trichloro-2-pyridinyl)amino]acetamide (PubChem CID 102750804) has the molecular formula C11H14Cl3N3O and a molecular weight of 310.61 g/mol. Its IUPAC name is 2-[2-methylpropyl-(3,5,6-trichloro-2-pyridinyl)amino]acetamide.
| Compound Name | 2-[2-methylpropyl-(3,5,6-trichloro-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 102750804 |
| Molecular Formula | C11H14Cl3N3O |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[2-methylpropyl-(3,5,6-trichloro-2-pyridinyl)amino]acetamide |
| SMILES | CC(C)CN(CC(N)=O)c1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3N3O/c1-6(2)4-17(5-9(15)18)11-8(13)3-7(12)10(14)16-11/h3,6H,4-5H2,1-2H3,(H2,15,18) |
| InChIKey | BFAZAEYMGLXILZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|