C13H18ClN3 — CID 115474204
6-chloro-2-N,2-N-bis(cyclopropylmethyl)pyridine-2,3-diamine (PubChem CID 115474204) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-bis(cyclopropylmethyl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N,2-N-bis(cyclopropylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115474204 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 6-chloro-2-N,2-N-bis(cyclopropylmethyl)pyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C13H18ClN3/c14-12-6-5-11(15)13(16-12)17(7-9-1-2-9)8-10-3-4-10/h5-6,9-10H,1-4,7-8,15H2 |
| InChIKey | HGHAKDDCXMTGSQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|