C12H18N4 — CID 116796967
2-N,2-N-bis(cyclopropylmethyl)pyrimidine-2,4-diamine (PubChem CID 116796967) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-N,2-N-bis(cyclopropylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N-bis(cyclopropylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796967 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-N,2-N-bis(cyclopropylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(N(CC2CC2)CC2CC2)n1 |
| InChI | InChI=1S/C12H18N4/c13-11-5-6-14-12(15-11)16(7-9-1-2-9)8-10-3-4-10/h5-6,9-10H,1-4,7-8H2,(H2,13,14,15) |
| InChIKey | HVNKPSCSWNTDRV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |