C9H12F3N5 — CID 107550563
2-[methyl(3,3,3-trifluoropropyl)amino]pyrimidine-4-carboximidamide (PubChem CID 107550563) has the molecular formula C9H12F3N5 and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-[methyl(3,3,3-trifluoropropyl)amino]pyrimidine-4-carboximidamide.
| Compound Name | 2-[methyl(3,3,3-trifluoropropyl)amino]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550563 |
| Molecular Formula | C9H12F3N5 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-[methyl(3,3,3-trifluoropropyl)amino]pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(N(C)CCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N5/c1-17(5-3-9(10,11)12)8-15-4-2-6(16-8)7(13)14/h2,4H,3,5H2,1H3,(H3,13,14) |
| InChIKey | DGYKMCPHJMMBCE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|