C11H12F6N4 — CID 79875005
2-[methyl(3,3,3-trifluoropropyl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide (PubChem CID 79875005) has the molecular formula C11H12F6N4 and a molecular weight of 314.23 g/mol. Its IUPAC name is 2-[methyl(3,3,3-trifluoropropyl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide.
| Compound Name | 2-[methyl(3,3,3-trifluoropropyl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 79875005 |
| Molecular Formula | C11H12F6N4 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-[methyl(3,3,3-trifluoropropyl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C(F)(F)F)nc1N(C)CCC(F)(F)F |
| InChI | InChI=1S/C11H12F6N4/c1-21(5-4-10(12,13)14)9-6(8(18)19)2-3-7(20-9)11(15,16)17/h2-3H,4-5H2,1H3,(H3,18,19) |
| InChIKey | MJUIWWJBDJRUTH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|