C13H19F3N4 — CID 79877396
2-[2,2-dimethylpropyl(methyl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide (PubChem CID 79877396) has the molecular formula C13H19F3N4 and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-[2,2-dimethylpropyl(methyl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide.
| Compound Name | 2-[2,2-dimethylpropyl(methyl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 79877396 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[2,2-dimethylpropyl(methyl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C(F)(F)F)nc1N(C)CC(C)(C)C |
| InChI | InChI=1S/C13H19F3N4/c1-12(2,3)7-20(4)11-8(10(17)18)5-6-9(19-11)13(14,15)16/h5-6H,7H2,1-4H3,(H3,17,18) |
| InChIKey | LKPGGAPDDCUXEZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|