C13H19F3N4O — CID 79874812
2-[3-hydroxypropyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide (PubChem CID 79874812) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-[3-hydroxypropyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide.
| Compound Name | 2-[3-hydroxypropyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 79874812 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[3-hydroxypropyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C(F)(F)F)nc1N(CCCO)C(C)C |
| InChI | InChI=1S/C13H19F3N4O/c1-8(2)20(6-3-7-21)12-9(11(17)18)4-5-10(19-12)13(14,15)16/h4-5,8,21H,3,6-7H2,1-2H3,(H3,17,18) |
| InChIKey | VERSLNVJYJQWHO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|