C11H12F4N2 — CID 55011299
1-N-cyclopropyl-2-fluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine (PubChem CID 55011299) has the molecular formula C11H12F4N2 and a molecular weight of 248.22 g/mol. Its IUPAC name is 1-N-cyclopropyl-2-fluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine.
| Compound Name | 1-N-cyclopropyl-2-fluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 55011299 |
| Molecular Formula | C11H12F4N2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-N-cyclopropyl-2-fluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(N(CC(F)(F)F)C2CC2)c(F)c1 |
| InChI | InChI=1S/C11H12F4N2/c12-9-5-7(16)1-4-10(9)17(8-2-3-8)6-11(13,14)15/h1,4-5,8H,2-3,6,16H2 |
| InChIKey | HFWPCFJCNJAMET-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|