C12H11F4NO2 — CID 55010433
2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid (PubChem CID 55010433) has the molecular formula C12H11F4NO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid.
| Compound Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 55010433 |
| Molecular Formula | C12H11F4NO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H11F4NO2/c13-7-1-4-10(9(5-7)11(18)19)17(8-2-3-8)6-12(14,15)16/h1,4-5,8H,2-3,6H2,(H,18,19) |
| InChIKey | IIGQLAGCUGLQBX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |