2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid

C12H11F4NO2 — CID 55010433

IUPAC2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid
SMILESO=C(O)c1cc(F)ccc1N(CC(F)(F)F)C1CC1
InChIInChI=1S/C12H11F4NO2/c13-7-1-4-10(9(5-7)11(18)19)17(8-2-3-8)6-12(14,15)16/h1,4-5,8H,2-3,6H2,(H,18,19)
InChIKeyIIGQLAGCUGLQBX-UHFFFAOYSA-N
MW277.22 g/mol
LogP3.06
Rot. Bonds4

About 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid

2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid (PubChem CID 55010433) has the molecular formula C12H11F4NO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid.

Molecular Properties

Compound Name2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid
PubChem CID55010433
Molecular FormulaC12H11F4NO2
Molecular Weight277.22 g/mol
Exact Mass277.07
IUPAC Name2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid
SMILESO=C(O)c1cc(F)ccc1N(CC(F)(F)F)C1CC1
InChIInChI=1S/C12H11F4NO2/c13-7-1-4-10(9(5-7)11(18)19)17(8-2-3-8)6-12(14,15)16/h1,4-5,8H,2-3,6H2,(H,18,19)
InChIKeyIIGQLAGCUGLQBX-UHFFFAOYSA-N
XLogP3.06
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.22
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid?
The IUPAC name of 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid (CID 55010433) is 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid.
What is the SMILES notation for 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid?
The canonical SMILES for 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid is O=C(O)c1cc(F)ccc1N(CC(F)(F)F)C1CC1.
What is the InChIKey of 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid?
The InChIKey is IIGQLAGCUGLQBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F4NO2/c13-7-1-4-10(9(5-7)11(18)19)17(8-2-3-8)6-12(14,15)16/h1,4-5,8H,2-3,6H2,(H,18,19).
What are the key properties of 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid?
2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid has a molecular weight of 277.22 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-5-fluorobenzoic acid is sourced from PubChem (CID 55010433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).