C15H14FNO2S — CID 61434471
2-[cyclopropyl(thiophen-3-ylmethyl)amino]-5-fluorobenzoic acid (PubChem CID 61434471) has the molecular formula C15H14FNO2S and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[cyclopropyl(thiophen-3-ylmethyl)amino]-5-fluorobenzoic acid.
| Compound Name | 2-[cyclopropyl(thiophen-3-ylmethyl)amino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 61434471 |
| Molecular Formula | C15H14FNO2S |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[cyclopropyl(thiophen-3-ylmethyl)amino]-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C15H14FNO2S/c16-11-1-4-14(13(7-11)15(18)19)17(12-2-3-12)8-10-5-6-20-9-10/h1,4-7,9,12H,2-3,8H2,(H,18,19) |
| InChIKey | KDJYWXGPVKKAHR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |