C13H16F3N3O — CID 107929868
2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-5-methylbenzenecarboximidamide (PubChem CID 107929868) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-5-methylbenzenecarboximidamide.
| Compound Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-5-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107929868 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-5-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(N(CC(F)(F)F)C2CC2)c(/C(N)=N/O)c1 |
| InChI | InChI=1S/C13H16F3N3O/c1-8-2-5-11(10(6-8)12(17)18-20)19(9-3-4-9)7-13(14,15)16/h2,5-6,9,20H,3-4,7H2,1H3,(H2,17,18) |
| InChIKey | NGJPTKSETCKBBQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|