C14H21FN2 — CID 28972591
1-N-cyclohexyl-1-N-ethyl-2-fluorobenzene-1,4-diamine (PubChem CID 28972591) has the molecular formula C14H21FN2 and a molecular weight of 236.33 g/mol. Its IUPAC name is 1-N-cyclohexyl-1-N-ethyl-2-fluorobenzene-1,4-diamine.
| Compound Name | 1-N-cyclohexyl-1-N-ethyl-2-fluorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 28972591 |
| Molecular Formula | C14H21FN2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 1-N-cyclohexyl-1-N-ethyl-2-fluorobenzene-1,4-diamine |
| SMILES | CCN(c1ccc(N)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C14H21FN2/c1-2-17(12-6-4-3-5-7-12)14-9-8-11(16)10-13(14)15/h8-10,12H,2-7,16H2,1H3 |
| InChIKey | HAFHQUWVGOUHLZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|