C14H27FN2 — CID 170720348
1-N,1-N-diethyl-2-fluorobenzene-1,4-diamine;ethane (PubChem CID 170720348) has the molecular formula C14H27FN2 and a molecular weight of 242.38 g/mol. Its IUPAC name is 1-N,1-N-diethyl-2-fluorobenzene-1,4-diamine;ethane.
| Compound Name | 1-N,1-N-diethyl-2-fluorobenzene-1,4-diamine;ethane |
|---|---|
| PubChem CID | 170720348 |
| Molecular Formula | C14H27FN2 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1-N,1-N-diethyl-2-fluorobenzene-1,4-diamine;ethane |
| SMILES | CC.CC.CCN(CC)c1ccc(N)cc1F |
| InChI | InChI=1S/C10H15FN2.2C2H6/c1-3-13(4-2)10-6-5-8(12)7-9(10)11;2*1-2/h5-7H,3-4,12H2,1-2H3;2*1-2H3 |
| InChIKey | OPWXWNBPDBDBIX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|