C12H12BrF3N2S — CID 114882234
2-bromo-6-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide (PubChem CID 114882234) has the molecular formula C12H12BrF3N2S and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-bromo-6-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide.
| Compound Name | 2-bromo-6-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114882234 |
| Molecular Formula | C12H12BrF3N2S |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2-bromo-6-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide |
| SMILES | NC(=S)c1c(Br)cccc1N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H12BrF3N2S/c13-8-2-1-3-9(10(8)11(17)19)18(7-4-5-7)6-12(14,15)16/h1-3,7H,4-6H2,(H2,17,19) |
| InChIKey | XNAJRWSJKXFJTL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|