C18H25N3 — CID 28809952
1-N,4-N,4-N-triethyl-1-N-phenylbenzene-1,2,4-triamine (PubChem CID 28809952) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-N,4-N,4-N-triethyl-1-N-phenylbenzene-1,2,4-triamine.
| Compound Name | 1-N,4-N,4-N-triethyl-1-N-phenylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 28809952 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 1-N,4-N,4-N-triethyl-1-N-phenylbenzene-1,2,4-triamine |
| SMILES | CCN(CC)c1ccc(N(CC)c2ccccc2)c(N)c1 |
| InChI | InChI=1S/C18H25N3/c1-4-20(5-2)16-12-13-18(17(19)14-16)21(6-3)15-10-8-7-9-11-15/h7-14H,4-6,19H2,1-3H3 |
| InChIKey | CJTPKKMNXXSLBS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|