C15H18N2O2S — CID 43447936
1-N-ethyl-4-methylsulfonyl-1-N-phenylbenzene-1,2-diamine (PubChem CID 43447936) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-N-ethyl-4-methylsulfonyl-1-N-phenylbenzene-1,2-diamine.
| Compound Name | 1-N-ethyl-4-methylsulfonyl-1-N-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 43447936 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-N-ethyl-4-methylsulfonyl-1-N-phenylbenzene-1,2-diamine |
| SMILES | CCN(c1ccccc1)c1ccc(S(C)(=O)=O)cc1N |
| InChI | InChI=1S/C15H18N2O2S/c1-3-17(12-7-5-4-6-8-12)15-10-9-13(11-14(15)16)20(2,18)19/h4-11H,3,16H2,1-2H3 |
| InChIKey | GQCHTIVOBGUDER-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|