C16H23N3O2S — CID 144610169
3-amino-4-(N-methylanilino)benzenesulfonamide;propane (PubChem CID 144610169) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 3-amino-4-(N-methylanilino)benzenesulfonamide;propane.
| Compound Name | 3-amino-4-(N-methylanilino)benzenesulfonamide;propane |
|---|---|
| PubChem CID | 144610169 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-amino-4-(N-methylanilino)benzenesulfonamide;propane |
| SMILES | CCC.CN(c1ccccc1)c1ccc(S(N)(=O)=O)cc1N |
| InChI | InChI=1S/C13H15N3O2S.C3H8/c1-16(10-5-3-2-4-6-10)13-8-7-11(9-12(13)14)19(15,17)18;1-3-2/h2-9H,14H2,1H3,(H2,15,17,18);3H2,1-2H3 |
| InChIKey | GSGBIWVKGLEMTK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|