C11H16F2N2 — CID 62531626
2-N-ethyl-3,4-difluoro-2-N-propylbenzene-1,2-diamine (PubChem CID 62531626) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-N-ethyl-3,4-difluoro-2-N-propylbenzene-1,2-diamine.
| Compound Name | 2-N-ethyl-3,4-difluoro-2-N-propylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 62531626 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-N-ethyl-3,4-difluoro-2-N-propylbenzene-1,2-diamine |
| SMILES | CCCN(CC)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C11H16F2N2/c1-3-7-15(4-2)11-9(14)6-5-8(12)10(11)13/h5-6H,3-4,7,14H2,1-2H3 |
| InChIKey | JRZHBQCFMDZUGS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|