C12H15F2N3O — CID 63285147
3-[6-amino-2,3-difluoro-N-(2-methoxyethyl)anilino]propanenitrile (PubChem CID 63285147) has the molecular formula C12H15F2N3O and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-[6-amino-2,3-difluoro-N-(2-methoxyethyl)anilino]propanenitrile.
| Compound Name | 3-[6-amino-2,3-difluoro-N-(2-methoxyethyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 63285147 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3-[6-amino-2,3-difluoro-N-(2-methoxyethyl)anilino]propanenitrile |
| SMILES | COCCN(CCC#N)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C12H15F2N3O/c1-18-8-7-17(6-2-5-15)12-10(16)4-3-9(13)11(12)14/h3-4H,2,6-8,16H2,1H3 |
| InChIKey | CDONPHVDWDNZRV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|