C12H16FN3O — CID 63285622
3-[2-amino-3-fluoro-N-(2-methoxyethyl)anilino]propanenitrile (PubChem CID 63285622) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-[2-amino-3-fluoro-N-(2-methoxyethyl)anilino]propanenitrile.
| Compound Name | 3-[2-amino-3-fluoro-N-(2-methoxyethyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 63285622 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-[2-amino-3-fluoro-N-(2-methoxyethyl)anilino]propanenitrile |
| SMILES | COCCN(CCC#N)c1cccc(F)c1N |
| InChI | InChI=1S/C12H16FN3O/c1-17-9-8-16(7-3-6-14)11-5-2-4-10(13)12(11)15/h2,4-5H,3,7-9,15H2,1H3 |
| InChIKey | HHHUOXBJZXIKON-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|