C10H14N4O — CID 63286973
3-[2-methoxyethyl(pyrimidin-2-yl)amino]propanenitrile (PubChem CID 63286973) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-[2-methoxyethyl(pyrimidin-2-yl)amino]propanenitrile.
| Compound Name | 3-[2-methoxyethyl(pyrimidin-2-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 63286973 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-[2-methoxyethyl(pyrimidin-2-yl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)c1ncccn1 |
| InChI | InChI=1S/C10H14N4O/c1-15-9-8-14(7-2-4-11)10-12-5-3-6-13-10/h3,5-6H,2,7-9H2,1H3 |
| InChIKey | LCPAAWWPUFRXMF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |