C11H17N5O — CID 80830637
3-[(2-amino-5-methylpyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile (PubChem CID 80830637) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-[(2-amino-5-methylpyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[(2-amino-5-methylpyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 80830637 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-[(2-amino-5-methylpyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)c1nc(N)ncc1C |
| InChI | InChI=1S/C11H17N5O/c1-9-8-14-11(13)15-10(9)16(5-3-4-12)6-7-17-2/h8H,3,5-7H2,1-2H3,(H2,13,14,15) |
| InChIKey | VEGRFQMFGQUPBG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |