C10H14ClN5O — CID 63285179
3-[(5-amino-6-chloropyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile (PubChem CID 63285179) has the molecular formula C10H14ClN5O and a molecular weight of 255.71 g/mol. Its IUPAC name is 3-[(5-amino-6-chloropyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[(5-amino-6-chloropyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 63285179 |
| Molecular Formula | C10H14ClN5O |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-[(5-amino-6-chloropyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)c1ncnc(Cl)c1N |
| InChI | InChI=1S/C10H14ClN5O/c1-17-6-5-16(4-2-3-12)10-8(13)9(11)14-7-15-10/h7H,2,4-6,13H2,1H3 |
| InChIKey | LWFZJXHOMGNJRM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |