C10H17ClN4O — CID 63698064
6-chloro-4-N-(2-ethoxyethyl)-4-N-ethylpyrimidine-4,5-diamine (PubChem CID 63698064) has the molecular formula C10H17ClN4O and a molecular weight of 244.73 g/mol. Its IUPAC name is 6-chloro-4-N-(2-ethoxyethyl)-4-N-ethylpyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-(2-ethoxyethyl)-4-N-ethylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 63698064 |
| Molecular Formula | C10H17ClN4O |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 6-chloro-4-N-(2-ethoxyethyl)-4-N-ethylpyrimidine-4,5-diamine |
| SMILES | CCOCCN(CC)c1ncnc(Cl)c1N |
| InChI | InChI=1S/C10H17ClN4O/c1-3-15(5-6-16-4-2)10-8(12)9(11)13-7-14-10/h7H,3-6,12H2,1-2H3 |
| InChIKey | XMMSFWCQMCKXQH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|