C10H13ClN4O2 — CID 136973019
3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile (PubChem CID 136973019) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 136973019 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C10H13ClN4O2/c1-17-6-5-15(4-2-3-12)9-8(11)10(16)14-7-13-9/h7H,2,4-6H2,1H3,(H,13,14,16) |
| InChIKey | KWDLPLLYYIEWDX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |