C9H14ClN3O3 — CID 136979824
5-chloro-4-[2-hydroxyethyl(2-methoxyethyl)amino]-1H-pyrimidin-6-one (PubChem CID 136979824) has the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. Its IUPAC name is 5-chloro-4-[2-hydroxyethyl(2-methoxyethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-hydroxyethyl(2-methoxyethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136979824 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 5-chloro-4-[2-hydroxyethyl(2-methoxyethyl)amino]-1H-pyrimidin-6-one |
| SMILES | COCCN(CCO)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C9H14ClN3O3/c1-16-5-3-13(2-4-14)8-7(10)9(15)12-6-11-8/h6,14H,2-5H2,1H3,(H,11,12,15) |
| InChIKey | JPTBBSBLCSFIRB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |